CAS 2243503-11-7 is the registry number for rac-(1R,5S)-3-Oxaspiro(bicyclo(3.1.0)hexane-2,3'-piperidine) hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R,5S)-spiro[3-oxabicyclo[3.1.0]hexane-2,3'-piperidine];hydrochloride (CAS 2243503-11-7) is a chemical compound with the molecular formula C9H16ClNO and a molecular weight of 189.68 g/mol. IUPAC name: (1R,5S)-spiro[3-oxabicyclo[3.1.0]hexane-2,3'-piperidine];hydrochloride. InChIKey: VFFCEHOMXPIKKE-HMEHNGNUSA-N.
| Molecular formula | C9H16ClNO |
|---|---|
| Molecular weight | 189.68 g/mol |
| IUPAC name | (1R,5S)-spiro[3-oxabicyclo[3.1.0]hexane-2,3'-piperidine];hydrochloride |
| InChIKey | VFFCEHOMXPIKKE-HMEHNGNUSA-N |
| SMILES | C1CC2(CNC1)[C@@H]3C[C@@H]3CO2.Cl |
Computed by PubChem (NCBI)