Products 2243503-46-8

CAS 2243503-46-8 is the registry number for 2-Amino-3-(2,5-dichlorothiophen-3-yl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-amino-3-(2,5-dichlorothiophen-3-yl)propanoic acid;hydrochloride (CAS 2243503-46-8) is a chemical compound with the molecular formula C7H8Cl3NO2S and a molecular weight of 276.6 g/mol. IUPAC name: 2-amino-3-(2,5-dichlorothiophen-3-yl)propanoic acid;hydrochloride. InChIKey: PVWKRYXCLPIAAP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8Cl3NO2S
Molecular weight276.6 g/mol
IUPAC name2-amino-3-(2,5-dichlorothiophen-3-yl)propanoic acid;hydrochloride
InChIKeyPVWKRYXCLPIAAP-UHFFFAOYSA-N
SMILESC1=C(SC(=C1CC(C(=O)O)N)Cl)Cl.Cl

Computed by PubChem (NCBI)