CAS 2243503-46-8 is the registry number for 2-Amino-3-(2,5-dichlorothiophen-3-yl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-3-(2,5-dichlorothiophen-3-yl)propanoic acid;hydrochloride (CAS 2243503-46-8) is a chemical compound with the molecular formula C7H8Cl3NO2S and a molecular weight of 276.6 g/mol. IUPAC name: 2-amino-3-(2,5-dichlorothiophen-3-yl)propanoic acid;hydrochloride. InChIKey: PVWKRYXCLPIAAP-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl3NO2S |
|---|---|
| Molecular weight | 276.6 g/mol |
| IUPAC name | 2-amino-3-(2,5-dichlorothiophen-3-yl)propanoic acid;hydrochloride |
| InChIKey | PVWKRYXCLPIAAP-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1CC(C(=O)O)N)Cl)Cl.Cl |
Computed by PubChem (NCBI)