CAS 2243504-33-6 is the registry number for rac-N-((3R,4S)-4-(1-Methyl-1H-imidazol-2-yl)pyrrolidin-3-yl)acetamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
N-[(3S,4R)-4-(1-methylimidazol-2-yl)pyrrolidin-3-yl]acetamide (CAS 2243504-33-6) is a chemical compound with the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. IUPAC name: N-[(3S,4R)-4-(1-methylimidazol-2-yl)pyrrolidin-3-yl]acetamide. InChIKey: KOUNBJXDTZRHFC-RKDXNWHRSA-N.
| Molecular formula | C10H16N4O |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | N-[(3S,4R)-4-(1-methylimidazol-2-yl)pyrrolidin-3-yl]acetamide |
| InChIKey | KOUNBJXDTZRHFC-RKDXNWHRSA-N |
| SMILES | CC(=O)N[C@@H]1CNC[C@H]1C2=NC=CN2C |
Computed by PubChem (NCBI)