CAS 2243506-19-4 is the registry number for 2-((2-Aminoethyl)({((9H-fluoren-9-yl)methoxy)carbonyl})amino)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[2-aminoethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid;hydrochloride (CAS 2243506-19-4) is a chemical compound with the molecular formula C19H21ClN2O4 and a molecular weight of 376.8 g/mol. IUPAC name: 2-[2-aminoethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid;hydrochloride. InChIKey: NOQJPKJSWIFGCJ-UHFFFAOYSA-N.
| Molecular formula | C19H21ClN2O4 |
|---|---|
| Molecular weight | 376.8 g/mol |
| IUPAC name | 2-[2-aminoethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid;hydrochloride |
| InChIKey | NOQJPKJSWIFGCJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N(CCN)CC(=O)O.Cl |
Computed by PubChem (NCBI)