Products 2243509-94-4

CAS 2243509-94-4 is the registry number for 1-ethylazetidin-3-amine bis(trifluoroacetic acid), 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.

Structural formula: {0} (CAS {1})

1-ethylazetidin-3-amine;bis(2,2,2-trifluoroacetic acid) (CAS 2243509-94-4) is a chemical compound with the molecular formula C9H14F6N2O4 and a molecular weight of 328.21 g/mol. IUPAC name: 1-ethylazetidin-3-amine;bis(2,2,2-trifluoroacetic acid). InChIKey: IIBFCUBKYXAGDK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14F6N2O4
Molecular weight328.21 g/mol
IUPAC name1-ethylazetidin-3-amine;bis(2,2,2-trifluoroacetic acid)
InChIKeyIIBFCUBKYXAGDK-UHFFFAOYSA-N
SMILESCCN1CC(C1)N.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)