CAS 2243510-22-5 is the registry number for rac-(1R,3S)-1,3-Dimethyl-6-propoxy-1,2,3,4-tetrahydroisoquinoline. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R,3S)-1,3-dimethyl-6-propoxy-1,2,3,4-tetrahydroisoquinoline (CAS 2243510-22-5) is a chemical compound with the molecular formula C14H21NO and a molecular weight of 219.32 g/mol. IUPAC name: (1R,3S)-1,3-dimethyl-6-propoxy-1,2,3,4-tetrahydroisoquinoline. InChIKey: LSCPXXITGHPXSH-WDEREUQCSA-N.
| Molecular formula | C14H21NO |
|---|---|
| Molecular weight | 219.32 g/mol |
| IUPAC name | (1R,3S)-1,3-dimethyl-6-propoxy-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | LSCPXXITGHPXSH-WDEREUQCSA-N |
| SMILES | CCCOC1=CC2=C(C=C1)[C@H](N[C@H](C2)C)C |
Computed by PubChem (NCBI)