Products 2243510-64-5

CAS 2243510-64-5 is the registry number for 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4,5-diethoxybenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4,5-diethoxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (CAS 2243510-64-5) is a chemical compound with the molecular formula C26H25NO6 and a molecular weight of 447.5 g/mol. IUPAC name: 4,5-diethoxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid. InChIKey: HLYQYEUJHZEMRF-UHFFFAOYSA-N.

Identity
Molecular formulaC26H25NO6
Molecular weight447.5 g/mol
IUPAC name4,5-diethoxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid
InChIKeyHLYQYEUJHZEMRF-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C(=C1)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)OCC

Computed by PubChem (NCBI)