Products 2243515-29-7

CAS 2243515-29-7 is the registry number for tert-Butyl 6-iodo-5-oxo-1,4-diazepane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 6-iodo-5-oxo-1,4-diazepane-1-carboxylate (CAS 2243515-29-7) is a chemical compound with the molecular formula C10H17IN2O3 and a molecular weight of 340.16 g/mol. IUPAC name: tert-butyl 6-iodo-5-oxo-1,4-diazepane-1-carboxylate. InChIKey: GQQLNMMURINQHB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17IN2O3
Molecular weight340.16 g/mol
IUPAC nametert-butyl 6-iodo-5-oxo-1,4-diazepane-1-carboxylate
InChIKeyGQQLNMMURINQHB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCNC(=O)C(C1)I

Computed by PubChem (NCBI)