Products 2243516-00-7

CAS 2243516-00-7 appears in our catalog under these names: 1,3-Dimethyl-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid, 98%, 1,3-Dimethyl-2-oxabicyclo(2.1.1)hexane-4-carboxylic acid. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1,3-dimethyl-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid (CAS 2243516-00-7) is a chemical compound with the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. IUPAC name: 1,3-dimethyl-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid. InChIKey: IWDRGBQGRGTFEV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12O3
Molecular weight156.18 g/mol
IUPAC name1,3-dimethyl-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid
InChIKeyIWDRGBQGRGTFEV-UHFFFAOYSA-N
SMILESCC1C2(CC(C2)(O1)C)C(=O)O

Computed by PubChem (NCBI)