Products 2243521-50-6
CAS 2243521-50-6 is the registry number for 5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine;hydrochloride (CAS 2243521-50-6) is a chemical compound with the molecular formula C14H22ClN and a molecular weight of 239.78 g/mol. IUPAC name: 5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine;hydrochloride. InChIKey: NQVLKZRRBDNENI-UHFFFAOYSA-N.
| Molecular formula | C14H22ClN |
|---|---|
| Molecular weight | 239.78 g/mol |
| IUPAC name | 5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine;hydrochloride |
| InChIKey | NQVLKZRRBDNENI-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=C1C=CC(=C2)N)(C)C)C.Cl |
Computed by PubChem (NCBI)