CAS 2243566-44-9 appears in our catalog under these names: Azidoethyl-ss-propionic nhs ester, 95%, Azidoethyl-SS-propionic NHS ester, ≥95%, ≥95%, Azidoethyl-SS-propionic NHS ester. Offered by: Combi-blocks, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, Get quote.
(2,5-dioxopyrrolidin-1-yl) 3-(2-azidoethyldisulfanyl)propanoate (CAS 2243566-44-9) is a chemical compound with the molecular formula C9H12N4O4S2 and a molecular weight of 304.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-(2-azidoethyldisulfanyl)propanoate. InChIKey: KEOGJOSSYXNLNK-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O4S2 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-(2-azidoethyldisulfanyl)propanoate |
| InChIKey | KEOGJOSSYXNLNK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCSSCCN=[N+]=[N-] |
Computed by PubChem (NCBI)