CAS 2243785-81-9 appears in our catalog under these names: N'-((2R,3S)-2-(Benzyloxy)pentan-3-yl)formohydrazide, 98%, Posaconazole Impurity 78, Posaconazole Impurity 130, 2-((1S,2R)-1-Ethyl-2-(phenylmethoxy)propyl)hydrazinecarboxaldehyde. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-[[(2R,3S)-2-phenylmethoxypentan-3-yl]amino]formamide (CAS 2243785-81-9) is a chemical compound with the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. IUPAC name: N-[[(2R,3S)-2-phenylmethoxypentan-3-yl]amino]formamide. InChIKey: LNEGZKZTVLXZFX-YPMHNXCESA-N.
| Molecular formula | C13H20N2O2 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | N-[[(2R,3S)-2-phenylmethoxypentan-3-yl]amino]formamide |
| InChIKey | LNEGZKZTVLXZFX-YPMHNXCESA-N |
| SMILES | CC[C@@H]([C@@H](C)OCC1=CC=CC=C1)NNC=O |
Computed by PubChem (NCBI)