CAS 2243786-10-7 is the registry number for Pyridinium Pentafluoroiodide - Hydrogenfluoride Complex. Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.
Pentafluoro-lambda5-iodane;pyridine;hydrofluoride (CAS 2243786-10-7) is a chemical compound with the molecular formula C5H6F6IN and a molecular weight of 321.00 g/mol. IUPAC name: pentafluoro-lambda5-iodane;pyridine;hydrofluoride. InChIKey: XQNUJXPHQGELCB-UHFFFAOYSA-N.
| Molecular formula | C5H6F6IN |
|---|---|
| Molecular weight | 321.00 g/mol |
| IUPAC name | pentafluoro-lambda5-iodane;pyridine;hydrofluoride |
| InChIKey | XQNUJXPHQGELCB-UHFFFAOYSA-N |
| SMILES | C1=CC=NC=C1.F.FI(F)(F)(F)F |
Computed by PubChem (NCBI)