Products 2243786-10-7

CAS 2243786-10-7 is the registry number for Pyridinium Pentafluoroiodide - Hydrogenfluoride Complex. Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.

Structural formula: {0} (CAS {1})

Pentafluoro-lambda5-iodane;pyridine;hydrofluoride (CAS 2243786-10-7) is a chemical compound with the molecular formula C5H6F6IN and a molecular weight of 321.00 g/mol. IUPAC name: pentafluoro-lambda5-iodane;pyridine;hydrofluoride. InChIKey: XQNUJXPHQGELCB-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6F6IN
Molecular weight321.00 g/mol
IUPAC namepentafluoro-lambda5-iodane;pyridine;hydrofluoride
InChIKeyXQNUJXPHQGELCB-UHFFFAOYSA-N
SMILESC1=CC=NC=C1.F.FI(F)(F)(F)F

Computed by PubChem (NCBI)