CAS 2243815-18-9 appears in our catalog under these names: Flunitrazolam, Flunitrazolam, 99.9%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg, 5 mg.
6-(2-fluorophenyl)-1-methyl-8-nitro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (CAS 2243815-18-9) is a chemical compound with the molecular formula C17H12FN5O2 and a molecular weight of 337.31 g/mol. IUPAC name: 6-(2-fluorophenyl)-1-methyl-8-nitro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine. InChIKey: RDLAGIOILLWVTM-UHFFFAOYSA-N.
| Molecular formula | C17H12FN5O2 |
|---|---|
| Molecular weight | 337.31 g/mol |
| IUPAC name | 6-(2-fluorophenyl)-1-methyl-8-nitro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| InChIKey | RDLAGIOILLWVTM-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1C3=C(C=C(C=C3)[N+](=O)[O-])C(=NC2)C4=CC=CC=C4F |
Computed by PubChem (NCBI)