CAS 2243909-59-1 appears in our catalog under these names: DNDI-6148, 98%, DNDI-6148/ 99.8% (existing batch purity), N-(1,3-Dihydro-1-hydroxy-2,1-benzoxaborol-6-yl)-5-methyl-1-(2-pyridinyl)-1H-1,2,3-triazole-4-carboxamide, DNDI-6148. Offered by: Chemat Brand, TargetMol, Chemat, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 2mg.
N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-5-methyl-1-pyridin-2-yltriazole-4-carboxamide (CAS 2243909-59-1) is a chemical compound with the molecular formula C16H14BN5O3 and a molecular weight of 335.1 g/mol. IUPAC name: N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-5-methyl-1-pyridin-2-yltriazole-4-carboxamide. InChIKey: NZLNNIUTJOYBMK-UHFFFAOYSA-N.
| Molecular formula | C16H14BN5O3 |
|---|---|
| Molecular weight | 335.1 g/mol |
| IUPAC name | N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-5-methyl-1-pyridin-2-yltriazole-4-carboxamide |
| InChIKey | NZLNNIUTJOYBMK-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=CC(=C2)NC(=O)C3=C(N(N=N3)C4=CC=CC=N4)C)O |
Computed by PubChem (NCBI)