CAS 2243923-83-1 is the registry number for Rel-(1R,3r,5S,6r)-3-((tert-butyldimethylsilyl)oxy)bicyclo[3.1.0]hexane-6-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,5S)-3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.1.0]hexane-6-carboxylic acid (CAS 2243923-83-1) is a chemical compound with the molecular formula C13H24O3Si and a molecular weight of 256.41 g/mol. IUPAC name: (1R,5S)-3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.1.0]hexane-6-carboxylic acid. InChIKey: FAYUTCCVLRVWFN-GGWWSXTCSA-N.
| Molecular formula | C13H24O3Si |
|---|---|
| Molecular weight | 256.41 g/mol |
| IUPAC name | (1R,5S)-3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.1.0]hexane-6-carboxylic acid |
| InChIKey | FAYUTCCVLRVWFN-GGWWSXTCSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1C[C@@H]2[C@H](C1)C2C(=O)O |
Computed by PubChem (NCBI)