CAS 22441-14-1 is the registry number for 2,2,6,6-Tetramethyl-3,5-heptanedionatopotassium, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Potassium 2,2,6,6-tetramethylheptane-3,5-dione (CAS 22441-14-1) is a chemical compound with the molecular formula C11H19KO2 and a molecular weight of 222.37 g/mol. IUPAC name: potassium 2,2,6,6-tetramethylheptane-3,5-dione. InChIKey: DUVXSNNQWZFKOY-UHFFFAOYSA-N.
| Molecular formula | C11H19KO2 |
|---|---|
| Molecular weight | 222.37 g/mol |
| IUPAC name | potassium 2,2,6,6-tetramethylheptane-3,5-dione |
| InChIKey | DUVXSNNQWZFKOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)[CH-]C(=O)C(C)(C)C.[K+] |
Computed by PubChem (NCBI)