CAS 2244161-71-3 appears in our catalog under these names: Dolutegravir Impurity 7, Dolutegravir Impurity 48, Dolutegravir Impurity 15, Desdifluoro Dolutegravir, DESFLUORO DOLUTEGRAVIR. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
(3S,7R)-N-benzyl-11-hydroxy-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide (CAS 2244161-71-3) is a chemical compound with the molecular formula C20H21N3O5 and a molecular weight of 383.4 g/mol. IUPAC name: (3S,7R)-N-benzyl-11-hydroxy-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide. InChIKey: HZVKFSFDIFAQFP-DOMZBBRYSA-N.
| Molecular formula | C20H21N3O5 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | (3S,7R)-N-benzyl-11-hydroxy-7-methyl-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-13-carboxamide |
| InChIKey | HZVKFSFDIFAQFP-DOMZBBRYSA-N |
| SMILES | C[C@@H]1CCO[C@@H]2N1C(=O)C3=C(C(=O)C(=CN3C2)C(=O)NCC4=CC=CC=C4)O |
Computed by PubChem (NCBI)