CAS 2244269-74-5 appears in our catalog under these names: GPR84 antagonist 2, GPR84 antagonist 2, 99%, 99%, GPR84 antagonist 2, 99.06%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 10mM/1mL, 25 mg, 10 mg, 100 mg, 5 mg.
Sodium bis(4-chlorobenzo[b][1]benzothiepin-6-yl) phosphate (CAS 2244269-74-5) is a chemical compound with the molecular formula C28H16Cl2NaO4PS2 and a molecular weight of 605.4 g/mol. IUPAC name: sodium bis(4-chlorobenzo[b][1]benzothiepin-6-yl) phosphate. InChIKey: JFIDCMUEKCPJLL-UHFFFAOYSA-M.
| Molecular formula | C28H16Cl2NaO4PS2 |
|---|---|
| Molecular weight | 605.4 g/mol |
| IUPAC name | sodium bis(4-chlorobenzo[b][1]benzothiepin-6-yl) phosphate |
| InChIKey | JFIDCMUEKCPJLL-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C(=CC3=C(S2)C=CC=C3Cl)OP(=O)([O-])OC4=CC5=C(C=CC=C5Cl)SC6=CC=CC=C64.[Na+] |
Computed by PubChem (NCBI)