CAS 224431-70-3 is the registry number for rel-(2R,3S)-3-(Benzyloxy)-2-methylcyclobutan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(2R,3S)-2-methyl-3-phenylmethoxycyclobutan-1-one (CAS 224431-70-3) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: cis-(2R,3S)-2-methyl-3-phenylmethoxycyclobutan-1-one. InChIKey: NXTOCOAXXNTKER-CABZTGNLSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | cis-(2R,3S)-2-methyl-3-phenylmethoxycyclobutan-1-one |
| InChIKey | NXTOCOAXXNTKER-CABZTGNLSA-N |
| SMILES | C[C@@H]1[C@H](CC1=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)