CAS 2244512-67-0 is the registry number for 1-Methyl-3-((trimethylsilyl)ethynyl)-1H-1,2,4-triazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trimethyl-[2-(1-methyl-1,2,4-triazol-3-yl)ethynyl]silane (CAS 2244512-67-0) is a chemical compound with the molecular formula C8H13N3Si and a molecular weight of 179.29 g/mol. IUPAC name: trimethyl-[2-(1-methyl-1,2,4-triazol-3-yl)ethynyl]silane. InChIKey: YICCOCWWRUISRB-UHFFFAOYSA-N.
| Molecular formula | C8H13N3Si |
|---|---|
| Molecular weight | 179.29 g/mol |
| IUPAC name | trimethyl-[2-(1-methyl-1,2,4-triazol-3-yl)ethynyl]silane |
| InChIKey | YICCOCWWRUISRB-UHFFFAOYSA-N |
| SMILES | CN1C=NC(=N1)C#C[Si](C)(C)C |
Computed by PubChem (NCBI)