CAS 2244864-90-0 is the registry number for FUB–NPB–22. Offered by: GLPBio. Available pack sizes: 1mg, 10mg, 5mg.
Quinolin-8-yl 1-[(4-fluorophenyl)methyl]indazole-3-carboxylate (CAS 2244864-90-0) is a chemical compound with the molecular formula C24H16FN3O2 and a molecular weight of 397.4 g/mol. IUPAC name: quinolin-8-yl 1-[(4-fluorophenyl)methyl]indazole-3-carboxylate. InChIKey: NYHGKZZRRCVGAU-UHFFFAOYSA-N.
| Molecular formula | C24H16FN3O2 |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | quinolin-8-yl 1-[(4-fluorophenyl)methyl]indazole-3-carboxylate |
| InChIKey | NYHGKZZRRCVGAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN2CC3=CC=C(C=C3)F)C(=O)OC4=CC=CC5=C4N=CC=C5 |
Computed by PubChem (NCBI)