Products 2244864-90-0

CAS 2244864-90-0 is the registry number for FUB–NPB–22. Offered by: GLPBio. Available pack sizes: 1mg, 10mg, 5mg.

Structural formula: {0} (CAS {1})

Quinolin-8-yl 1-[(4-fluorophenyl)methyl]indazole-3-carboxylate (CAS 2244864-90-0) is a chemical compound with the molecular formula C24H16FN3O2 and a molecular weight of 397.4 g/mol. IUPAC name: quinolin-8-yl 1-[(4-fluorophenyl)methyl]indazole-3-carboxylate. InChIKey: NYHGKZZRRCVGAU-UHFFFAOYSA-N.

Identity
Molecular formulaC24H16FN3O2
Molecular weight397.4 g/mol
IUPAC namequinolin-8-yl 1-[(4-fluorophenyl)methyl]indazole-3-carboxylate
InChIKeyNYHGKZZRRCVGAU-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=NN2CC3=CC=C(C=C3)F)C(=O)OC4=CC=CC5=C4N=CC=C5

Computed by PubChem (NCBI)