Products 2244986-85-2
CAS 2244986-85-2 is the registry number for MTP3 ligand-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[2-(4-cyanophenyl)-6-(furan-2-yl)-4-pyridinyl]benzoic acid (CAS 2244986-85-2) is a chemical compound with the molecular formula C23H14N2O3 and a molecular weight of 366.4 g/mol. IUPAC name: 4-[2-(4-cyanophenyl)-6-(furan-2-yl)-4-pyridinyl]benzoic acid. InChIKey: DYRCRIODASBLHD-UHFFFAOYSA-N.
| Molecular formula | C23H14N2O3 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 4-[2-(4-cyanophenyl)-6-(furan-2-yl)-4-pyridinyl]benzoic acid |
| InChIKey | DYRCRIODASBLHD-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC(=CC(=N2)C3=CC=C(C=C3)C#N)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)