CAS 2245111-15-1 appears in our catalog under these names: 4,6-Dichloropyridazine-3-carboxylic acid, lithium salt hydrate, 98%, Lithium 4,6-dichloropyridazine-3-carboxylate hydrate, 98%. Offered by: Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 250mg, 1g, 100g.
Lithium;4,6-dichloropyridazine-3-carboxylate;hydrate (CAS 2245111-15-1) is a chemical compound with the molecular formula C5H3Cl2LiN2O3 and a molecular weight of 217.0 g/mol. IUPAC name: lithium;4,6-dichloropyridazine-3-carboxylate;hydrate. InChIKey: KOGSKEZOKTYPFE-UHFFFAOYSA-M.
| Molecular formula | C5H3Cl2LiN2O3 |
|---|---|
| Molecular weight | 217.0 g/mol |
| IUPAC name | lithium;4,6-dichloropyridazine-3-carboxylate;hydrate |
| InChIKey | KOGSKEZOKTYPFE-UHFFFAOYSA-M |
| SMILES | [Li+].C1=C(C(=NN=C1Cl)C(=O)[O-])Cl.O |
Computed by PubChem (NCBI)