CAS 2245358-35-2 is the registry number for tert-Butyl (5,6-difluoro-9H-pyrido[2,3-b]indol-8-yl)(methyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(5,6-difluoro-9H-pyrido[2,3-b]indol-8-yl)-N-methylcarbamate (CAS 2245358-35-2) is a chemical compound with the molecular formula C17H17F2N3O2 and a molecular weight of 333.33 g/mol. IUPAC name: tert-butyl N-(5,6-difluoro-9H-pyrido[2,3-b]indol-8-yl)-N-methylcarbamate. InChIKey: PUORZRGIYDWPCW-UHFFFAOYSA-N.
| Molecular formula | C17H17F2N3O2 |
|---|---|
| Molecular weight | 333.33 g/mol |
| IUPAC name | tert-butyl N-(5,6-difluoro-9H-pyrido[2,3-b]indol-8-yl)-N-methylcarbamate |
| InChIKey | PUORZRGIYDWPCW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=CC(=C(C2=C1NC3=C2C=CC=N3)F)F |
Computed by PubChem (NCBI)