CAS 2245359-66-2 is the registry number for N-Boc-3-(trifluoromethyl)-1H-pyrazole-4-methanamine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-[[5-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]carbamate (CAS 2245359-66-2) is a chemical compound with the molecular formula C10H14F3N3O2 and a molecular weight of 265.23 g/mol. IUPAC name: tert-butyl N-[[5-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]carbamate. InChIKey: PMDWJOOVBDAUON-UHFFFAOYSA-N.
| Molecular formula | C10H14F3N3O2 |
|---|---|
| Molecular weight | 265.23 g/mol |
| IUPAC name | tert-butyl N-[[5-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]carbamate |
| InChIKey | PMDWJOOVBDAUON-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=C(NN=C1)C(F)(F)F |
Computed by PubChem (NCBI)