CAS 2245360-96-5 is the registry number for tert-Butyl (2-amino-4,5-difluorophenyl)(methyl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(2-amino-4,5-difluorophenyl)-N-methylcarbamate (CAS 2245360-96-5) is a chemical compound with the molecular formula C12H16F2N2O2 and a molecular weight of 258.26 g/mol. IUPAC name: tert-butyl N-(2-amino-4,5-difluorophenyl)-N-methylcarbamate. InChIKey: FRJCUFABYCRTHC-UHFFFAOYSA-N.
| Molecular formula | C12H16F2N2O2 |
|---|---|
| Molecular weight | 258.26 g/mol |
| IUPAC name | tert-butyl N-(2-amino-4,5-difluorophenyl)-N-methylcarbamate |
| InChIKey | FRJCUFABYCRTHC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=CC(=C(C=C1N)F)F |
Computed by PubChem (NCBI)