CAS 2245691-60-3 is the registry number for Type II topoisomerase inhibitor 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[8-(methylamino)-2-oxo-1H-quinoline-3-carbonyl]amino]benzoic acid (CAS 2245691-60-3) is a chemical compound with the molecular formula C18H15N3O4 and a molecular weight of 337.3 g/mol. IUPAC name: 4-[[8-(methylamino)-2-oxo-1H-quinoline-3-carbonyl]amino]benzoic acid. InChIKey: VUXYPRAXFABKBH-UHFFFAOYSA-N.
| Molecular formula | C18H15N3O4 |
|---|---|
| Molecular weight | 337.3 g/mol |
| IUPAC name | 4-[[8-(methylamino)-2-oxo-1H-quinoline-3-carbonyl]amino]benzoic acid |
| InChIKey | VUXYPRAXFABKBH-UHFFFAOYSA-N |
| SMILES | CNC1=CC=CC2=C1NC(=O)C(=C2)C(=O)NC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)