Products 2245711-21-9
CAS 2245711-21-9 is the registry number for L-Carnitine(mono)-O-glutaryl-d3 (perchlorate), 98.0%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg, 500 μg.
[(2R)-3-carboxy-2-(4-carboxybutanoyloxy)propyl]-dimethyl-(trideuteriomethyl)azanium perchlorate (CAS 2245711-21-9) is a chemical compound with the molecular formula C12H22ClNO10 and a molecular weight of 378.77 g/mol. IUPAC name: [(2R)-3-carboxy-2-(4-carboxybutanoyloxy)propyl]-dimethyl-(trideuteriomethyl)azanium perchlorate. InChIKey: ZBHHJGORGXTIQI-AXHFJGNISA-N.
| Molecular formula | C12H22ClNO10 |
|---|---|
| Molecular weight | 378.77 g/mol |
| IUPAC name | [(2R)-3-carboxy-2-(4-carboxybutanoyloxy)propyl]-dimethyl-(trideuteriomethyl)azanium perchlorate |
| InChIKey | ZBHHJGORGXTIQI-AXHFJGNISA-N |
| SMILES | [2H]C([2H])([2H])[N+](C)(C)C[C@@H](CC(=O)O)OC(=O)CCCC(=O)O.[O-]Cl(=O)(=O)=O |
Computed by PubChem (NCBI)