Products 2245820-70-4
CAS 2245820-70-4 is the registry number for RIPK2-IN-1. Offered by: MedChemExpress. Available pack sizes: 10 mg, 1 mg, 5 mg.
N-[3-[2-amino-5-(4-piperazin-1-ylphenyl)-3-pyridinyl]-5-methoxyphenyl]methanesulfonamide (CAS 2245820-70-4) is a chemical compound with the molecular formula C23H27N5O3S and a molecular weight of 453.6 g/mol. IUPAC name: N-[3-[2-amino-5-(4-piperazin-1-ylphenyl)-3-pyridinyl]-5-methoxyphenyl]methanesulfonamide. InChIKey: WTNLXMJMLHJDKF-UHFFFAOYSA-N.
| Molecular formula | C23H27N5O3S |
|---|---|
| Molecular weight | 453.6 g/mol |
| IUPAC name | N-[3-[2-amino-5-(4-piperazin-1-ylphenyl)-3-pyridinyl]-5-methoxyphenyl]methanesulfonamide |
| InChIKey | WTNLXMJMLHJDKF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)NS(=O)(=O)C)C2=C(N=CC(=C2)C3=CC=C(C=C3)N4CCNCC4)N |
Computed by PubChem (NCBI)
Synonyms:
KRE, orb1687260