Products 2246700-34-3
CAS 2246700-34-3 is the registry number for 3-Methyl-N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)benzamide, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide (CAS 2246700-34-3) is a chemical compound with the molecular formula C20H24BNO3 and a molecular weight of 337.2 g/mol. IUPAC name: 3-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide. InChIKey: IPSUTWOXLPTXRG-UHFFFAOYSA-N.
| Molecular formula | C20H24BNO3 |
|---|---|
| Molecular weight | 337.2 g/mol |
| IUPAC name | 3-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzamide |
| InChIKey | IPSUTWOXLPTXRG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)C3=CC=CC(=C3)C |
Computed by PubChem (NCBI)