Products 2246800-14-4
CAS 2246800-14-4 is the registry number for (3-(Isobutyramidomethyl)phenyl)boronic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[3-[(2-methylpropanoylamino)methyl]phenyl]boronic acid (CAS 2246800-14-4) is a chemical compound with the molecular formula C11H16BNO3 and a molecular weight of 221.06 g/mol. IUPAC name: [3-[(2-methylpropanoylamino)methyl]phenyl]boronic acid. InChIKey: MARMKUNOASUDBD-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO3 |
|---|---|
| Molecular weight | 221.06 g/mol |
| IUPAC name | [3-[(2-methylpropanoylamino)methyl]phenyl]boronic acid |
| InChIKey | MARMKUNOASUDBD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CNC(=O)C(C)C)(O)O |
Computed by PubChem (NCBI)