CAS 2246875-19-2 is the registry number for (1-(4,4,4-Trifluoro-2,2-dimethylbutyl)-1H-pyrazol-3-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[1-(4,4,4-trifluoro-2,2-dimethylbutyl)pyrazol-3-yl]boronic acid (CAS 2246875-19-2) is a chemical compound with the molecular formula C9H14BF3N2O2 and a molecular weight of 250.03 g/mol. IUPAC name: [1-(4,4,4-trifluoro-2,2-dimethylbutyl)pyrazol-3-yl]boronic acid. InChIKey: LCTFVFDGCGZVGP-UHFFFAOYSA-N.
| Molecular formula | C9H14BF3N2O2 |
|---|---|
| Molecular weight | 250.03 g/mol |
| IUPAC name | [1-(4,4,4-trifluoro-2,2-dimethylbutyl)pyrazol-3-yl]boronic acid |
| InChIKey | LCTFVFDGCGZVGP-UHFFFAOYSA-N |
| SMILES | B(C1=NN(C=C1)CC(C)(C)CC(F)(F)F)(O)O |
Computed by PubChem (NCBI)