CAS 2246894-62-0 appears in our catalog under these names: (4-(((N,N-Dimethylsulfamoyl)amino)methyl)phenyl)boronic acid, 95%, (4-(((N,N-Dimethylsulfamoyl)amino)methyl)phenyl)boronic acid, 98%, (4–(((N,N–dimethylsulfamoyl)amino)methyl)phenyl)boronic acid, (4-(((N,N-dimethylsulfamoyl)amino)methyl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
[4-[(dimethylsulfamoylamino)methyl]phenyl]boronic acid (CAS 2246894-62-0) is a chemical compound with the molecular formula C9H15BN2O4S and a molecular weight of 258.11 g/mol. IUPAC name: [4-[(dimethylsulfamoylamino)methyl]phenyl]boronic acid. InChIKey: ILGRPFGXQVLKML-UHFFFAOYSA-N.
| Molecular formula | C9H15BN2O4S |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | [4-[(dimethylsulfamoylamino)methyl]phenyl]boronic acid |
| InChIKey | ILGRPFGXQVLKML-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CNS(=O)(=O)N(C)C)(O)O |
Computed by PubChem (NCBI)