CAS 2247034-62-2 is the registry number for 1,3,5-Tris((3,5-dimethyl-1H-pyrazol-1-yl)methyl)benzene, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[[3,5-bis[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]methyl]-3,5-dimethylpyrazole (CAS 2247034-62-2) is a chemical compound with the molecular formula C24H30N6 and a molecular weight of 402.5 g/mol. IUPAC name: 1-[[3,5-bis[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]methyl]-3,5-dimethylpyrazole. InChIKey: JYUCJXRORBICDH-UHFFFAOYSA-N.
| Molecular formula | C24H30N6 |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | 1-[[3,5-bis[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]methyl]-3,5-dimethylpyrazole |
| InChIKey | JYUCJXRORBICDH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CC2=CC(=CC(=C2)CN3C(=CC(=N3)C)C)CN4C(=CC(=N4)C)C)C |
Computed by PubChem (NCBI)