CAS 2247102-23-2 is the registry number for rac-(1R,3R)-3-(Dimethylamino)cyclopentan-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Trans-(1R,3R)-3-(dimethylamino)cyclopentan-1-ol;hydrochloride (CAS 2247102-23-2) is a chemical compound with the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. IUPAC name: trans-(1R,3R)-3-(dimethylamino)cyclopentan-1-ol;hydrochloride. InChIKey: LEXAGCFGLWHAOU-ZJLYAJKPSA-N.
| Molecular formula | C7H16ClNO |
|---|---|
| Molecular weight | 165.66 g/mol |
| IUPAC name | trans-(1R,3R)-3-(dimethylamino)cyclopentan-1-ol;hydrochloride |
| InChIKey | LEXAGCFGLWHAOU-ZJLYAJKPSA-N |
| SMILES | CN(C)[C@@H]1CC[C@H](C1)O.Cl |
Computed by PubChem (NCBI)