CAS 2247102-72-1 is the registry number for Potassium 2-(1,3-oxazol-5-yl)acetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Potassium 2-(1,3-oxazol-5-yl)acetate (CAS 2247102-72-1) is a chemical compound with the molecular formula C5H4KNO3 and a molecular weight of 165.19 g/mol. IUPAC name: potassium 2-(1,3-oxazol-5-yl)acetate. InChIKey: SZDXHONSBRUJIX-UHFFFAOYSA-M.
| Molecular formula | C5H4KNO3 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | potassium 2-(1,3-oxazol-5-yl)acetate |
| InChIKey | SZDXHONSBRUJIX-UHFFFAOYSA-M |
| SMILES | C1=C(OC=N1)CC(=O)[O-].[K+] |
Computed by PubChem (NCBI)