CAS 2247105-98-0 is the registry number for rac-(3aR,8aR)-4-Methoxy-7,7-dimethyl-2H,3H,3aH,6H,7H,8H,8aH-furo(3,2-c)azepine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3aS,8aS)-4-methoxy-7,7-dimethyl-2,3,3a,6,8,8a-hexahydrofuro[3,2-c]azepine (CAS 2247105-98-0) is a chemical compound with the molecular formula C11H19NO2 and a molecular weight of 197.27 g/mol. IUPAC name: (3aS,8aS)-4-methoxy-7,7-dimethyl-2,3,3a,6,8,8a-hexahydrofuro[3,2-c]azepine. InChIKey: SLIDFCKJFFSBAM-IUCAKERBSA-N.
| Molecular formula | C11H19NO2 |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | (3aS,8aS)-4-methoxy-7,7-dimethyl-2,3,3a,6,8,8a-hexahydrofuro[3,2-c]azepine |
| InChIKey | SLIDFCKJFFSBAM-IUCAKERBSA-N |
| SMILES | CC1(C[C@H]2[C@H](CCO2)C(=NC1)OC)C |
Computed by PubChem (NCBI)