Products 2247107-80-6
CAS 2247107-80-6 is the registry number for 2-Amino-1-cyclopropyl-2-(3-fluoro-4-methylphenyl)ethan-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-1-cyclopropyl-2-(3-fluoro-4-methylphenyl)ethanol;hydrochloride (CAS 2247107-80-6) is a chemical compound with the molecular formula C12H17ClFNO and a molecular weight of 245.72 g/mol. IUPAC name: 2-amino-1-cyclopropyl-2-(3-fluoro-4-methylphenyl)ethanol;hydrochloride. InChIKey: ISOVEEXXXJTTIZ-UHFFFAOYSA-N.
| Molecular formula | C12H17ClFNO |
|---|---|
| Molecular weight | 245.72 g/mol |
| IUPAC name | 2-amino-1-cyclopropyl-2-(3-fluoro-4-methylphenyl)ethanol;hydrochloride |
| InChIKey | ISOVEEXXXJTTIZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C(C2CC2)O)N)F.Cl |
Computed by PubChem (NCBI)