CAS 2247349-46-6 is the registry number for 3,5-Difluoro-4-iodo-N,N-dimethylbenzenamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
3,5-difluoro-4-iodo-N,N-dimethylaniline (CAS 2247349-46-6) is a chemical compound with the molecular formula C8H8F2IN and a molecular weight of 283.06 g/mol. IUPAC name: 3,5-difluoro-4-iodo-N,N-dimethylaniline. InChIKey: IRFFLYCZMLYCKR-UHFFFAOYSA-N.
| Molecular formula | C8H8F2IN |
|---|---|
| Molecular weight | 283.06 g/mol |
| IUPAC name | 3,5-difluoro-4-iodo-N,N-dimethylaniline |
| InChIKey | IRFFLYCZMLYCKR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C(=C1)F)I)F |
Computed by PubChem (NCBI)