Products 2247391-82-6
CAS 2247391-82-6 is the registry number for P-BP-SFAC. Offered by: MedChemExpress. Available pack sizes: Get quote.
Phenyl-(4-spiro[acridine-9,9'-fluorene]-10-ylphenyl)methanone (CAS 2247391-82-6) is a chemical compound with the molecular formula C38H25NO and a molecular weight of 511.6 g/mol. IUPAC name: phenyl-(4-spiro[acridine-9,9'-fluorene]-10-ylphenyl)methanone. InChIKey: SXQGGDUVTUJNPG-UHFFFAOYSA-N.
| Molecular formula | C38H25NO |
|---|---|
| Molecular weight | 511.6 g/mol |
| IUPAC name | phenyl-(4-spiro[acridine-9,9'-fluorene]-10-ylphenyl)methanone |
| InChIKey | SXQGGDUVTUJNPG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)N3C4=CC=CC=C4C5(C6=CC=CC=C6C7=CC=CC=C75)C8=CC=CC=C83 |
Computed by PubChem (NCBI)