Products 2247489-93-4
CAS 2247489-93-4 is the registry number for In1122 Impurity 53. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(3S,3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrol-3-ol (CAS 2247489-93-4) is a chemical compound with the molecular formula C7H13NO and a molecular weight of 127.18 g/mol. IUPAC name: (3S,3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrol-3-ol. InChIKey: OMTDZTIZMPWNBU-RRKCRQDMSA-N.
| Molecular formula | C7H13NO |
|---|---|
| Molecular weight | 127.18 g/mol |
| IUPAC name | (3S,3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrol-3-ol |
| InChIKey | OMTDZTIZMPWNBU-RRKCRQDMSA-N |
| SMILES | C1C[C@H]2[C@@H](C1)NC[C@H]2O |
Computed by PubChem (NCBI)