Products 22478-65-5
CAS 22478-65-5 appears in our catalog under these names: 18-Norabieta-8,11,13-trien-4-ol, 18-Norabieta-8,11,13-trien-4α-ol. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, Get quote.
(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-ol (CAS 22478-65-5) is a chemical compound with the molecular formula C19H28O and a molecular weight of 272.4 g/mol. IUPAC name: (1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-ol. InChIKey: SOJWLJKPIIODOH-GUDVDZBRSA-N.
| Molecular formula | C19H28O |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | (1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-ol |
| InChIKey | SOJWLJKPIIODOH-GUDVDZBRSA-N |
| SMILES | CC(C)C1=CC2=C(C=C1)[C@]3(CCC[C@@]([C@@H]3CC2)(C)O)C |
Computed by PubChem (NCBI)