CAS 2248173-00-2 is the registry number for (S)-2-(3,3-Difluorocyclobutyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(3,3-difluorocyclobutyl)propanoic acid (CAS 2248173-00-2) is a chemical compound with the molecular formula C7H10F2O2 and a molecular weight of 164.15 g/mol. IUPAC name: (2S)-2-(3,3-difluorocyclobutyl)propanoic acid. InChIKey: MHEXWFSDZUNBPG-BYPYZUCNSA-N.
| Molecular formula | C7H10F2O2 |
|---|---|
| Molecular weight | 164.15 g/mol |
| IUPAC name | (2S)-2-(3,3-difluorocyclobutyl)propanoic acid |
| InChIKey | MHEXWFSDZUNBPG-BYPYZUCNSA-N |
| SMILES | C[C@@H](C1CC(C1)(F)F)C(=O)O |
Computed by PubChem (NCBI)