CAS 2248173-10-4 is the registry number for (2R,3aR,6aS)-5,5-difluorooctahydropentalen-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3aS,6aR)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-amine (CAS 2248173-10-4) is a chemical compound with the molecular formula C8H13F2N and a molecular weight of 161.19 g/mol. IUPAC name: (3aS,6aR)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-amine. InChIKey: ZVGNSKWEOGCMNG-MEKDEQNOSA-N.
| Molecular formula | C8H13F2N |
|---|---|
| Molecular weight | 161.19 g/mol |
| IUPAC name | (3aS,6aR)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-amine |
| InChIKey | ZVGNSKWEOGCMNG-MEKDEQNOSA-N |
| SMILES | C1[C@@H]2CC(C[C@@H]2CC1N)(F)F |
Computed by PubChem (NCBI)