CAS 2248255-17-4 is the registry number for 2-(4-Fluorophenyl)-4H-benzo[4,5]imidazo[2,1-b][1,3]thiazin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-fluorophenyl)-[1,3]thiazino[3,2-a]benzimidazol-4-one (CAS 2248255-17-4) is a chemical compound with the molecular formula C16H9FN2OS and a molecular weight of 296.3 g/mol. IUPAC name: 2-(4-fluorophenyl)-[1,3]thiazino[3,2-a]benzimidazol-4-one. InChIKey: RJGXWQQCUVFBRO-UHFFFAOYSA-N.
| Molecular formula | C16H9FN2OS |
|---|---|
| Molecular weight | 296.3 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-[1,3]thiazino[3,2-a]benzimidazol-4-one |
| InChIKey | RJGXWQQCUVFBRO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3N2C(=O)C=C(S3)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)