CAS 2248272-78-6 is the registry number for 2-(3,4-Difluorophenyl)-3-methylbutan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(3,4-difluorophenyl)-3-methylbutan-1-amine;hydrochloride (CAS 2248272-78-6) is a chemical compound with the molecular formula C11H16ClF2N and a molecular weight of 235.70 g/mol. IUPAC name: 2-(3,4-difluorophenyl)-3-methylbutan-1-amine;hydrochloride. InChIKey: OOXRGRHYGPMFTE-UHFFFAOYSA-N.
| Molecular formula | C11H16ClF2N |
|---|---|
| Molecular weight | 235.70 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)-3-methylbutan-1-amine;hydrochloride |
| InChIKey | OOXRGRHYGPMFTE-UHFFFAOYSA-N |
| SMILES | CC(C)C(CN)C1=CC(=C(C=C1)F)F.Cl |
Computed by PubChem (NCBI)