CAS 2248297-90-5 is the registry number for Lithium(1+) ion 3-carboxyprop-2-ynoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Lithium 4-hydroxy-4-oxobut-2-ynoate (CAS 2248297-90-5) is a chemical compound with the molecular formula C4HLiO4 and a molecular weight of 120.0 g/mol. IUPAC name: lithium 4-hydroxy-4-oxobut-2-ynoate. InChIKey: OVVFKKXKGJPYJT-UHFFFAOYSA-M.
| Molecular formula | C4HLiO4 |
|---|---|
| Molecular weight | 120.0 g/mol |
| IUPAC name | lithium 4-hydroxy-4-oxobut-2-ynoate |
| InChIKey | OVVFKKXKGJPYJT-UHFFFAOYSA-M |
| SMILES | [Li+].C(#CC(=O)[O-])C(=O)O |
Computed by PubChem (NCBI)