CAS 2248327-17-3 appears in our catalog under these names: Lithium 5-bromo-1,3,4-thiadiazole-2-carboxylate, 95%, Lithium 5-bromo-1,3,4-thiadiazole-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Lithium 5-bromo-1,3,4-thiadiazole-2-carboxylate (CAS 2248327-17-3) is a chemical compound with the molecular formula C3BrLiN2O2S and a molecular weight of 215.0 g/mol. IUPAC name: lithium 5-bromo-1,3,4-thiadiazole-2-carboxylate. InChIKey: SVBBTGNUIHVKMI-UHFFFAOYSA-M.
| Molecular formula | C3BrLiN2O2S |
|---|---|
| Molecular weight | 215.0 g/mol |
| IUPAC name | lithium 5-bromo-1,3,4-thiadiazole-2-carboxylate |
| InChIKey | SVBBTGNUIHVKMI-UHFFFAOYSA-M |
| SMILES | [Li+].C1(=NN=C(S1)Br)C(=O)[O-] |
Computed by PubChem (NCBI)