Products 2248374-24-3
CAS 2248374-24-3 is the registry number for 1-Bromo-4-(difluoromethyl)-2,3,5,6-tetrafluorobenzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-4-(difluoromethyl)-2,3,5,6-tetrafluorobenzene (CAS 2248374-24-3) is a chemical compound with the molecular formula C7HBrF6 and a molecular weight of 278.98 g/mol. IUPAC name: 1-bromo-4-(difluoromethyl)-2,3,5,6-tetrafluorobenzene. InChIKey: ZFGNMHQJQYXKQQ-UHFFFAOYSA-N.
| Molecular formula | C7HBrF6 |
|---|---|
| Molecular weight | 278.98 g/mol |
| IUPAC name | 1-bromo-4-(difluoromethyl)-2,3,5,6-tetrafluorobenzene |
| InChIKey | ZFGNMHQJQYXKQQ-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)Br)F)F)C(F)F |
Computed by PubChem (NCBI)